C15H16ClN5O2 — CID 133340689
6-chloro-3-[2-[3-(methylcarbamoyl)phenyl]ethylamino]pyridazine-4-carboxamide (PubChem CID 133340689) has the molecular formula C15H16ClN5O2 and a molecular weight of 333.78 g/mol. Its IUPAC name is 6-chloro-3-[2-[3-(methylcarbamoyl)phenyl]ethylamino]pyridazine-4-carboxamide.
| Compound Name | 6-chloro-3-[2-[3-(methylcarbamoyl)phenyl]ethylamino]pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 133340689 |
| Molecular Formula | C15H16ClN5O2 |
| Molecular Weight | 333.78 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 6-chloro-3-[2-[3-(methylcarbamoyl)phenyl]ethylamino]pyridazine-4-carboxamide |
| SMILES | CNC(=O)c1cccc(CCNc2nnc(Cl)cc2C(N)=O)c1 |
| InChI | InChI=1S/C15H16ClN5O2/c1-18-15(23)10-4-2-3-9(7-10)5-6-19-14-11(13(17)22)8-12(16)20-21-14/h2-4,7-8H,5-6H2,1H3,(H2,17,22)(H,18,23)(H,19,21) |
| InChIKey | BBJBUPMZSNPGNG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.78 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |