About 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide
4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide (PubChem CID 133343566) has the molecular formula C14H16F3N3O2S2
and a molecular weight of 379.43 g/mol. Its IUPAC name is 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide |
| PubChem CID | 133343566 |
| Molecular Formula | C14H16F3N3O2S2 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide |
| SMILES | CCc1nc(CCNc2ccc(S(N)(=O)=O)c(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C14H16F3N3O2S2/c1-2-13-20-10(8-23-13)5-6-19-9-3-4-12(24(18,21)22)11(7-9)14(15,16)17/h3-4,7-8,19H,2,5-6H2,1H3,(H2,18,21,22) |
| InChIKey | ZKRQOYOSYSHVJI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide?
The IUPAC name of 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide (CID 133343566) is 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide.
What is the SMILES notation for 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide?
The canonical SMILES for 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide is CCc1nc(CCNc2ccc(S(N)(=O)=O)c(C(F)(F)F)c2)cs1.
What is the InChIKey of 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide?
The InChIKey is ZKRQOYOSYSHVJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F3N3O2S2/c1-2-13-20-10(8-23-13)5-6-19-9-3-4-12(24(18,21)22)11(7-9)14(15,16)17/h3-4,7-8,19H,2,5-6H2,1H3,(H2,18,21,22).
What are the key properties of 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide?
4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide has a molecular weight of 379.43 g/mol, XLogP of 3.03, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(2-ethyl-1,3-thiazol-4-yl)ethylamino]-2-(trifluoromethyl)benzenesulfonamide is sourced from PubChem (CID 133343566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).