C22H26ClN5O — CID 133346754
[5-chloro-6-[3-(1-methylbenzimidazol-2-yl)propylamino]-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 133346754) has the molecular formula C22H26ClN5O and a molecular weight of 411.94 g/mol. Its IUPAC name is [5-chloro-6-[3-(1-methylbenzimidazol-2-yl)propylamino]-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [5-chloro-6-[3-(1-methylbenzimidazol-2-yl)propylamino]-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 133346754 |
| Molecular Formula | C22H26ClN5O |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [5-chloro-6-[3-(1-methylbenzimidazol-2-yl)propylamino]-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | Cn1c(CCCNc2ncc(C(=O)N3CCCCC3)cc2Cl)nc2ccccc21 |
| InChI | InChI=1S/C22H26ClN5O/c1-27-19-9-4-3-8-18(19)26-20(27)10-7-11-24-21-17(23)14-16(15-25-21)22(29)28-12-5-2-6-13-28/h3-4,8-9,14-15H,2,5-7,10-13H2,1H3,(H,24,25) |
| InChIKey | TWVDUKRZCIJQOY-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|