C22H27ClN4O2 — CID 56555861
N-benzyl-3-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]amino]-N-methylpropanamide (PubChem CID 56555861) has the molecular formula C22H27ClN4O2 and a molecular weight of 414.94 g/mol. Its IUPAC name is N-benzyl-3-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]amino]-N-methylpropanamide.
| Compound Name | N-benzyl-3-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 56555861 |
| Molecular Formula | C22H27ClN4O2 |
| Molecular Weight | 414.94 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | N-benzyl-3-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]amino]-N-methylpropanamide |
| SMILES | CN(Cc1ccccc1)C(=O)CCNc1ncc(C(=O)N2CCCCC2)cc1Cl |
| InChI | InChI=1S/C22H27ClN4O2/c1-26(16-17-8-4-2-5-9-17)20(28)10-11-24-21-19(23)14-18(15-25-21)22(29)27-12-6-3-7-13-27/h2,4-5,8-9,14-15H,3,6-7,10-13,16H2,1H3,(H,24,25) |
| InChIKey | LLDCNSJFSIXQMS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.94 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |