C19H22ClN5O2 — CID 60561707
N-[2-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 60561707) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60561707 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | N-[2-[[3-chloro-5-(piperidine-1-carbonyl)-2-pyridinyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | O=C(NCCNc1ncc(C(=O)N2CCCCC2)cc1Cl)c1cccnc1 |
| InChI | InChI=1S/C19H22ClN5O2/c20-16-11-15(19(27)25-9-2-1-3-10-25)13-24-17(16)22-7-8-23-18(26)14-5-4-6-21-12-14/h4-6,11-13H,1-3,7-10H2,(H,22,24)(H,23,26) |
| InChIKey | NDTSHWZPFYYQLV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|