C22H20FN3O — CID 133350466
6-[[(3-fluorophenyl)-phenylmethyl]amino]-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 133350466) has the molecular formula C22H20FN3O and a molecular weight of 361.42 g/mol. Its IUPAC name is 6-[[(3-fluorophenyl)-phenylmethyl]amino]-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 6-[[(3-fluorophenyl)-phenylmethyl]amino]-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133350466 |
| Molecular Formula | C22H20FN3O |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 6-[[(3-fluorophenyl)-phenylmethyl]amino]-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(NC(c2ccccc2)c2cccc(F)c2)nc1 |
| InChI | InChI=1S/C22H20FN3O/c1-2-13-24-22(27)18-11-12-20(25-15-18)26-21(16-7-4-3-5-8-16)17-9-6-10-19(23)14-17/h2-12,14-15,21H,1,13H2,(H,24,27)(H,25,26) |
| InChIKey | XUDOTELNCUBCTB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|