C17H23N5O — CID 75374086
6-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 75374086) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 6-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 6-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 75374086 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 6-[1-(3,5-dimethylpyrazol-1-yl)propan-2-ylamino]-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(NC(C)Cn2nc(C)cc2C)nc1 |
| InChI | InChI=1S/C17H23N5O/c1-5-8-18-17(23)15-6-7-16(19-10-15)20-13(3)11-22-14(4)9-12(2)21-22/h5-7,9-10,13H,1,8,11H2,2-4H3,(H,18,23)(H,19,20) |
| InChIKey | NKAJRVQUTZYWPQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|