C17H22N4OS — CID 133346231
6-[1-(2-propan-2-yl-1,3-thiazol-4-yl)ethylamino]-N-prop-2-enylpyridine-3-carboxamide (PubChem CID 133346231) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 6-[1-(2-propan-2-yl-1,3-thiazol-4-yl)ethylamino]-N-prop-2-enylpyridine-3-carboxamide.
| Compound Name | 6-[1-(2-propan-2-yl-1,3-thiazol-4-yl)ethylamino]-N-prop-2-enylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 133346231 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 6-[1-(2-propan-2-yl-1,3-thiazol-4-yl)ethylamino]-N-prop-2-enylpyridine-3-carboxamide |
| SMILES | C=CCNC(=O)c1ccc(NC(C)c2csc(C(C)C)n2)nc1 |
| InChI | InChI=1S/C17H22N4OS/c1-5-8-18-16(22)13-6-7-15(19-9-13)20-12(4)14-10-23-17(21-14)11(2)3/h5-7,9-12H,1,8H2,2-4H3,(H,18,22)(H,19,20) |
| InChIKey | CFQKZIYHDLDQJS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|