C15H16F2N4O3S — CID 133352522
N-[2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 133352522) has the molecular formula C15H16F2N4O3S and a molecular weight of 370.38 g/mol. Its IUPAC name is N-[2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 133352522 |
| Molecular Formula | C15H16F2N4O3S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-[2-[[5-[(3,5-difluorophenyl)sulfamoyl]-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1ccc(S(=O)(=O)Nc2cc(F)cc(F)c2)cn1 |
| InChI | InChI=1S/C15H16F2N4O3S/c1-10(22)18-4-5-19-15-3-2-14(9-20-15)25(23,24)21-13-7-11(16)6-12(17)8-13/h2-3,6-9,21H,4-5H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | FSXXOZXLLGHBMG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|