C18H20ClN5 — CID 133359214
6-chloro-5-ethyl-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylpyrimidin-4-amine (PubChem CID 133359214) has the molecular formula C18H20ClN5 and a molecular weight of 341.85 g/mol. Its IUPAC name is 6-chloro-5-ethyl-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-chloro-5-ethyl-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133359214 |
| Molecular Formula | C18H20ClN5 |
| Molecular Weight | 341.85 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 6-chloro-5-ethyl-N-[[4-(imidazol-1-ylmethyl)phenyl]methyl]-2-methylpyrimidin-4-amine |
| SMILES | CCc1c(Cl)nc(C)nc1NCc1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C18H20ClN5/c1-3-16-17(19)22-13(2)23-18(16)21-10-14-4-6-15(7-5-14)11-24-9-8-20-12-24/h4-9,12H,3,10-11H2,1-2H3,(H,21,22,23) |
| InChIKey | OLUQNEGQFOCLFL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.85 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |