C16H14N6 — CID 133283472
3-[[4-(imidazol-1-ylmethyl)phenyl]methylamino]pyrazine-2-carbonitrile (PubChem CID 133283472) has the molecular formula C16H14N6 and a molecular weight of 290.33 g/mol. Its IUPAC name is 3-[[4-(imidazol-1-ylmethyl)phenyl]methylamino]pyrazine-2-carbonitrile.
| Compound Name | 3-[[4-(imidazol-1-ylmethyl)phenyl]methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133283472 |
| Molecular Formula | C16H14N6 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-[[4-(imidazol-1-ylmethyl)phenyl]methylamino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1nccnc1NCc1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C16H14N6/c17-9-15-16(20-6-5-19-15)21-10-13-1-3-14(4-2-13)11-22-8-7-18-12-22/h1-8,12H,10-11H2,(H,20,21) |
| InChIKey | OEVWLVRFZPGIKJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |