C21H16F3N3O — CID 133359862
2-[[4-(pyridin-2-ylmethoxy)phenyl]methylamino]-5-(trifluoromethyl)benzonitrile (PubChem CID 133359862) has the molecular formula C21H16F3N3O and a molecular weight of 383.37 g/mol. Its IUPAC name is 2-[[4-(pyridin-2-ylmethoxy)phenyl]methylamino]-5-(trifluoromethyl)benzonitrile.
| Compound Name | 2-[[4-(pyridin-2-ylmethoxy)phenyl]methylamino]-5-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 133359862 |
| Molecular Formula | C21H16F3N3O |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-[[4-(pyridin-2-ylmethoxy)phenyl]methylamino]-5-(trifluoromethyl)benzonitrile |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1NCc1ccc(OCc2ccccn2)cc1 |
| InChI | InChI=1S/C21H16F3N3O/c22-21(23,24)17-6-9-20(16(11-17)12-25)27-13-15-4-7-19(8-5-15)28-14-18-3-1-2-10-26-18/h1-11,27H,13-14H2 |
| InChIKey | LBISFHKAMNRVLG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |