C17H19N5O2S — CID 133361525
N-methyl-6-[1-(2-pyrazol-1-ylphenyl)ethylamino]pyridine-3-sulfonamide (PubChem CID 133361525) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is N-methyl-6-[1-(2-pyrazol-1-ylphenyl)ethylamino]pyridine-3-sulfonamide.
| Compound Name | N-methyl-6-[1-(2-pyrazol-1-ylphenyl)ethylamino]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133361525 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-methyl-6-[1-(2-pyrazol-1-ylphenyl)ethylamino]pyridine-3-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(NC(C)c2ccccc2-n2cccn2)nc1 |
| InChI | InChI=1S/C17H19N5O2S/c1-13(15-6-3-4-7-16(15)22-11-5-10-20-22)21-17-9-8-14(12-19-17)25(23,24)18-2/h3-13,18H,1-2H3,(H,19,21) |
| InChIKey | GIIXLZKIBSNBRW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |