C12H21N3O2S2 — CID 133363012
2-[4-(2-methylpropyl)piperidin-1-yl]-1,3-thiazole-5-sulfonamide (PubChem CID 133363012) has the molecular formula C12H21N3O2S2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-[4-(2-methylpropyl)piperidin-1-yl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[4-(2-methylpropyl)piperidin-1-yl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 133363012 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-[4-(2-methylpropyl)piperidin-1-yl]-1,3-thiazole-5-sulfonamide |
| SMILES | CC(C)CC1CCN(c2ncc(S(N)(=O)=O)s2)CC1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-9(2)7-10-3-5-15(6-4-10)12-14-8-11(18-12)19(13,16)17/h8-10H,3-7H2,1-2H3,(H2,13,16,17) |
| InChIKey | FJZIFDITOYEVRA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |