C10H15N3O4S2 — CID 122106742
5-methyl-1-(5-sulfamoyl-1,3-thiazol-2-yl)piperidine-3-carboxylic acid (PubChem CID 122106742) has the molecular formula C10H15N3O4S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 5-methyl-1-(5-sulfamoyl-1,3-thiazol-2-yl)piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-(5-sulfamoyl-1,3-thiazol-2-yl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122106742 |
| Molecular Formula | C10H15N3O4S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 5-methyl-1-(5-sulfamoyl-1,3-thiazol-2-yl)piperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(c2ncc(S(N)(=O)=O)s2)C1 |
| InChI | InChI=1S/C10H15N3O4S2/c1-6-2-7(9(14)15)5-13(4-6)10-12-3-8(18-10)19(11,16)17/h3,6-7H,2,4-5H2,1H3,(H,14,15)(H2,11,16,17) |
| InChIKey | CHPJTCHEZRFKRK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |