C9H12F3N3O2S2 — CID 95288282
2-[(3S)-3-(trifluoromethyl)piperidin-1-yl]-1,3-thiazole-5-sulfonamide (PubChem CID 95288282) has the molecular formula C9H12F3N3O2S2 and a molecular weight of 315.34 g/mol. Its IUPAC name is 2-[(3S)-3-(trifluoromethyl)piperidin-1-yl]-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-[(3S)-3-(trifluoromethyl)piperidin-1-yl]-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 95288282 |
| Molecular Formula | C9H12F3N3O2S2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-[(3S)-3-(trifluoromethyl)piperidin-1-yl]-1,3-thiazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cnc(N2CCC[C@H](C(F)(F)F)C2)s1 |
| InChI | InChI=1S/C9H12F3N3O2S2/c10-9(11,12)6-2-1-3-15(5-6)8-14-4-7(18-8)19(13,16)17/h4,6H,1-3,5H2,(H2,13,16,17)/t6-/m0/s1 |
| InChIKey | SZVBLRXPRJDEIS-LURJTMIESA-N |
| XLogP | 1.57 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |