C8H10ClFN2S — CID 130626861
5-chloro-2-(3-fluoropiperidin-1-yl)-1,3-thiazole (PubChem CID 130626861) has the molecular formula C8H10ClFN2S and a molecular weight of 220.70 g/mol. Its IUPAC name is 5-chloro-2-(3-fluoropiperidin-1-yl)-1,3-thiazole.
| Compound Name | 5-chloro-2-(3-fluoropiperidin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 130626861 |
| Molecular Formula | C8H10ClFN2S |
| Molecular Weight | 220.70 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 5-chloro-2-(3-fluoropiperidin-1-yl)-1,3-thiazole |
| SMILES | FC1CCCN(c2ncc(Cl)s2)C1 |
| InChI | InChI=1S/C8H10ClFN2S/c9-7-4-11-8(13-7)12-3-1-2-6(10)5-12/h4,6H,1-3,5H2 |
| InChIKey | AQTIBMGRBLBPSE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.70 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |