C18H18N4OS — CID 133363568
4-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)-2-thiophen-2-ylmorpholine (PubChem CID 133363568) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is 4-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)-2-thiophen-2-ylmorpholine.
| Compound Name | 4-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)-2-thiophen-2-ylmorpholine |
|---|---|
| PubChem CID | 133363568 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 4-(6-methyl-2-pyridin-3-ylpyrimidin-4-yl)-2-thiophen-2-ylmorpholine |
| SMILES | Cc1cc(N2CCOC(c3cccs3)C2)nc(-c2cccnc2)n1 |
| InChI | InChI=1S/C18H18N4OS/c1-13-10-17(21-18(20-13)14-4-2-6-19-11-14)22-7-8-23-15(12-22)16-5-3-9-24-16/h2-6,9-11,15H,7-8,12H2,1H3 |
| InChIKey | CADYGDNIIMDHQB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |