C15H17N7O2 — CID 133365455
1,3-dimethyl-4-nitro-N-[1-(1-phenyltriazol-4-yl)ethyl]pyrazol-5-amine (PubChem CID 133365455) has the molecular formula C15H17N7O2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 1,3-dimethyl-4-nitro-N-[1-(1-phenyltriazol-4-yl)ethyl]pyrazol-5-amine.
| Compound Name | 1,3-dimethyl-4-nitro-N-[1-(1-phenyltriazol-4-yl)ethyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 133365455 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1,3-dimethyl-4-nitro-N-[1-(1-phenyltriazol-4-yl)ethyl]pyrazol-5-amine |
| SMILES | Cc1nn(C)c(NC(C)c2cn(-c3ccccc3)nn2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N7O2/c1-10(16-15-14(22(23)24)11(2)18-20(15)3)13-9-21(19-17-13)12-7-5-4-6-8-12/h4-10,16H,1-3H3 |
| InChIKey | XMKPFMHSHCVJHI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|