C15H19N3S — CID 133366101
5-propan-2-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 133366101) has the molecular formula C15H19N3S and a molecular weight of 273.41 g/mol. Its IUPAC name is 5-propan-2-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-propan-2-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 133366101 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.41 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 5-propan-2-yl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CC(C)c1nnc(NC2CCCc3ccccc32)s1 |
| InChI | InChI=1S/C15H19N3S/c1-10(2)14-17-18-15(19-14)16-13-9-5-7-11-6-3-4-8-12(11)13/h3-4,6,8,10,13H,5,7,9H2,1-2H3,(H,16,18) |
| InChIKey | YFZRXECIZXARNS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |