C13H10F4N4O2 — CID 133370714
N-(4-nitrophenyl)-N'-(2,3,5,6-tetrafluoro-4-pyridinyl)ethane-1,2-diamine (PubChem CID 133370714) has the molecular formula C13H10F4N4O2 and a molecular weight of 330.24 g/mol. Its IUPAC name is N-(4-nitrophenyl)-N'-(2,3,5,6-tetrafluoro-4-pyridinyl)ethane-1,2-diamine.
| Compound Name | N-(4-nitrophenyl)-N'-(2,3,5,6-tetrafluoro-4-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 133370714 |
| Molecular Formula | C13H10F4N4O2 |
| Molecular Weight | 330.24 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | N-(4-nitrophenyl)-N'-(2,3,5,6-tetrafluoro-4-pyridinyl)ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1ccc(NCCNc2c(F)c(F)nc(F)c2F)cc1 |
| InChI | InChI=1S/C13H10F4N4O2/c14-9-11(10(15)13(17)20-12(9)16)19-6-5-18-7-1-3-8(4-2-7)21(22)23/h1-4,18H,5-6H2,(H,19,20) |
| InChIKey | BATQADGYGKAVOG-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.24 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|