C17H14ClF4N5S — CID 133370903
1-[4-(4-chlorophenyl)-5-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]-N,N-dimethylethanamine (PubChem CID 133370903) has the molecular formula C17H14ClF4N5S and a molecular weight of 431.85 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)-5-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]-N,N-dimethylethanamine.
| Compound Name | 1-[4-(4-chlorophenyl)-5-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 133370903 |
| Molecular Formula | C17H14ClF4N5S |
| Molecular Weight | 431.85 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 1-[4-(4-chlorophenyl)-5-[(2,3,5,6-tetrafluoro-4-pyridinyl)sulfanyl]-1,2,4-triazol-3-yl]-N,N-dimethylethanamine |
| SMILES | CC(c1nnc(Sc2c(F)c(F)nc(F)c2F)n1-c1ccc(Cl)cc1)N(C)C |
| InChI | InChI=1S/C17H14ClF4N5S/c1-8(26(2)3)16-24-25-17(27(16)10-6-4-9(18)5-7-10)28-13-11(19)14(21)23-15(22)12(13)20/h4-8H,1-3H3 |
| InChIKey | KOHJDRKAOKDJMM-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|