C16H15F4N3 — CID 133371653
2,3,5,6-tetrafluoro-N-(1-phenylpiperidin-4-yl)pyridin-4-amine (PubChem CID 133371653) has the molecular formula C16H15F4N3 and a molecular weight of 325.31 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N-(1-phenylpiperidin-4-yl)pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N-(1-phenylpiperidin-4-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 133371653 |
| Molecular Formula | C16H15F4N3 |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N-(1-phenylpiperidin-4-yl)pyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(NC2CCN(c3ccccc3)CC2)c1F |
| InChI | InChI=1S/C16H15F4N3/c17-12-14(13(18)16(20)22-15(12)19)21-10-6-8-23(9-7-10)11-4-2-1-3-5-11/h1-5,10H,6-9H2,(H,21,22) |
| InChIKey | SRJLXZDHVJFFRI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|