C12H15F4N3O — CID 133371825
N-butan-2-yl-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide (PubChem CID 133371825) has the molecular formula C12H15F4N3O and a molecular weight of 293.26 g/mol. Its IUPAC name is N-butan-2-yl-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide.
| Compound Name | N-butan-2-yl-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide |
|---|---|
| PubChem CID | 133371825 |
| Molecular Formula | C12H15F4N3O |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-butan-2-yl-2-[(2,3,5,6-tetrafluoro-4-pyridinyl)amino]propanamide |
| SMILES | CCC(C)NC(=O)C(C)Nc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C12H15F4N3O/c1-4-5(2)17-12(20)6(3)18-9-7(13)10(15)19-11(16)8(9)14/h5-6H,4H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | VGBWBVDXNGWYDP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|