C16H8F4N2O2S — CID 133372305
N-[4-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]phenyl]thiophene-3-carboxamide (PubChem CID 133372305) has the molecular formula C16H8F4N2O2S and a molecular weight of 368.31 g/mol. Its IUPAC name is N-[4-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]phenyl]thiophene-3-carboxamide.
| Compound Name | N-[4-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]phenyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 133372305 |
| Molecular Formula | C16H8F4N2O2S |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N-[4-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxy]phenyl]thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2c(F)c(F)nc(F)c2F)cc1)c1ccsc1 |
| InChI | InChI=1S/C16H8F4N2O2S/c17-11-13(12(18)15(20)22-14(11)19)24-10-3-1-9(2-4-10)21-16(23)8-5-6-25-7-8/h1-7H,(H,21,23) |
| InChIKey | AYGLCHOPXFUNEM-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|