C15H11N7O4S — CID 133374442
2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 133374442) has the molecular formula C15H11N7O4S and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 133374442 |
| Molecular Formula | C15H11N7O4S |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | 2-[[4-amino-5-(2-methylfuran-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1occc1-c1nnc(Sc2nc3ccccn3c(=O)c2[N+](=O)[O-])n1N |
| InChI | InChI=1S/C15H11N7O4S/c1-8-9(5-7-26-8)12-18-19-15(21(12)16)27-13-11(22(24)25)14(23)20-6-3-2-4-10(20)17-13/h2-7H,16H2,1H3 |
| InChIKey | VWVBUFCNPIXBQN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|