C14H16N4O4S — CID 133408519
2-(2-morpholin-4-ylethylsulfanyl)-3-nitropyrido[1,2-a]pyrimidin-4-one (PubChem CID 133408519) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethylsulfanyl)-3-nitropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(2-morpholin-4-ylethylsulfanyl)-3-nitropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 133408519 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-(2-morpholin-4-ylethylsulfanyl)-3-nitropyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1c([N+](=O)[O-])c(SCCN2CCOCC2)nc2ccccn12 |
| InChI | InChI=1S/C14H16N4O4S/c19-14-12(18(20)21)13(15-11-3-1-2-4-17(11)14)23-10-7-16-5-8-22-9-6-16/h1-4H,5-10H2 |
| InChIKey | HVRFAMFWOJDRQI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|