C17H24F3N3O — CID 133376350
2-[4-[[6-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]cyclohexan-1-ol (PubChem CID 133376350) has the molecular formula C17H24F3N3O and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-[4-[[6-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]cyclohexan-1-ol.
| Compound Name | 2-[4-[[6-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 133376350 |
| Molecular Formula | C17H24F3N3O |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 2-[4-[[6-(trifluoromethyl)-2-pyridinyl]amino]piperidin-1-yl]cyclohexan-1-ol |
| SMILES | OC1CCCCC1N1CCC(Nc2cccc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C17H24F3N3O/c18-17(19,20)15-6-3-7-16(22-15)21-12-8-10-23(11-9-12)13-4-1-2-5-14(13)24/h3,6-7,12-14,24H,1-2,4-5,8-11H2,(H,21,22) |
| InChIKey | RHPFMLICDALGMZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 48.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |