C15H8Cl2N6O2 — CID 133377236
4-[[1-(3,5-dichloro-2-pyridinyl)pyrazol-4-yl]amino]-3-nitrobenzonitrile (PubChem CID 133377236) has the molecular formula C15H8Cl2N6O2 and a molecular weight of 375.18 g/mol. Its IUPAC name is 4-[[1-(3,5-dichloro-2-pyridinyl)pyrazol-4-yl]amino]-3-nitrobenzonitrile.
| Compound Name | 4-[[1-(3,5-dichloro-2-pyridinyl)pyrazol-4-yl]amino]-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 133377236 |
| Molecular Formula | C15H8Cl2N6O2 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 374.01 |
| IUPAC Name | 4-[[1-(3,5-dichloro-2-pyridinyl)pyrazol-4-yl]amino]-3-nitrobenzonitrile |
| SMILES | N#Cc1ccc(Nc2cnn(-c3ncc(Cl)cc3Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H8Cl2N6O2/c16-10-4-12(17)15(19-6-10)22-8-11(7-20-22)21-13-2-1-9(5-18)3-14(13)23(24)25/h1-4,6-8,21H |
| InChIKey | VHMZABCLEJAYKG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|