C18H21ClFN3O2 — CID 133377505
1-[4-[(4-chloro-8-fluoroquinolin-7-yl)amino]piperidin-1-yl]-3-methoxypropan-1-one (PubChem CID 133377505) has the molecular formula C18H21ClFN3O2 and a molecular weight of 365.84 g/mol. Its IUPAC name is 1-[4-[(4-chloro-8-fluoroquinolin-7-yl)amino]piperidin-1-yl]-3-methoxypropan-1-one.
| Compound Name | 1-[4-[(4-chloro-8-fluoroquinolin-7-yl)amino]piperidin-1-yl]-3-methoxypropan-1-one |
|---|---|
| PubChem CID | 133377505 |
| Molecular Formula | C18H21ClFN3O2 |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 1-[4-[(4-chloro-8-fluoroquinolin-7-yl)amino]piperidin-1-yl]-3-methoxypropan-1-one |
| SMILES | COCCC(=O)N1CCC(Nc2ccc3c(Cl)ccnc3c2F)CC1 |
| InChI | InChI=1S/C18H21ClFN3O2/c1-25-11-7-16(24)23-9-5-12(6-10-23)22-15-3-2-13-14(19)4-8-21-18(13)17(15)20/h2-4,8,12,22H,5-7,9-11H2,1H3 |
| InChIKey | PLPSFOOSWYDEFN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |