C19H23N5OS — CID 133384632
(1-methylimidazol-2-yl)-[1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-3-yl]methanol (PubChem CID 133384632) has the molecular formula C19H23N5OS and a molecular weight of 369.49 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-3-yl]methanol.
| Compound Name | (1-methylimidazol-2-yl)-[1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 133384632 |
| Molecular Formula | C19H23N5OS |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (1-methylimidazol-2-yl)-[1-(7-thia-9,11-diazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),8,10-tetraen-12-yl)piperidin-3-yl]methanol |
| SMILES | Cn1ccnc1C(O)C1CCCN(c2ncnc3sc4c(c23)CCC4)C1 |
| InChI | InChI=1S/C19H23N5OS/c1-23-9-7-20-18(23)16(25)12-4-3-8-24(10-12)17-15-13-5-2-6-14(13)26-19(15)22-11-21-17/h7,9,11-12,16,25H,2-6,8,10H2,1H3 |
| InChIKey | BGYODHMQYMGPMM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |