C17H19N5 — CID 133385979
N-[(1-cyclopentylpyrazol-3-yl)methyl]quinazolin-4-amine (PubChem CID 133385979) has the molecular formula C17H19N5 and a molecular weight of 293.37 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-3-yl)methyl]quinazolin-4-amine.
| Compound Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 133385979 |
| Molecular Formula | C17H19N5 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-3-yl)methyl]quinazolin-4-amine |
| SMILES | c1ccc2c(NCc3ccn(C4CCCC4)n3)ncnc2c1 |
| InChI | InChI=1S/C17H19N5/c1-2-6-14(5-1)22-10-9-13(21-22)11-18-17-15-7-3-4-8-16(15)19-12-20-17/h3-4,7-10,12,14H,1-2,5-6,11H2,(H,18,19,20) |
| InChIKey | FAINJWZNWGZTBP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |