C16H18ClN3O2S — CID 133388376
6-chloro-N-(1,1-dioxothiolan-3-yl)-5-ethyl-2-phenylpyrimidin-4-amine (PubChem CID 133388376) has the molecular formula C16H18ClN3O2S and a molecular weight of 351.86 g/mol. Its IUPAC name is 6-chloro-N-(1,1-dioxothiolan-3-yl)-5-ethyl-2-phenylpyrimidin-4-amine.
| Compound Name | 6-chloro-N-(1,1-dioxothiolan-3-yl)-5-ethyl-2-phenylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133388376 |
| Molecular Formula | C16H18ClN3O2S |
| Molecular Weight | 351.86 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 6-chloro-N-(1,1-dioxothiolan-3-yl)-5-ethyl-2-phenylpyrimidin-4-amine |
| SMILES | CCc1c(Cl)nc(-c2ccccc2)nc1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H18ClN3O2S/c1-2-13-14(17)19-15(11-6-4-3-5-7-11)20-16(13)18-12-8-9-23(21,22)10-12/h3-7,12H,2,8-10H2,1H3,(H,18,19,20) |
| InChIKey | BIOXBQQDUYSIAE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.86 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |