C16H18N2OS — CID 133390475
N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 133390475) has the molecular formula C16H18N2OS and a molecular weight of 286.40 g/mol. Its IUPAC name is N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 133390475 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | C1=C(CCNc2nc(-c3ccccc3)cs2)CCOC1 |
| InChI | InChI=1S/C16H18N2OS/c1-2-4-14(5-3-1)15-12-20-16(18-15)17-9-6-13-7-10-19-11-8-13/h1-5,7,12H,6,8-11H2,(H,17,18) |
| InChIKey | ISMCAKOJZCJJLE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|