C17H14Cl2N2O — CID 13339481
(3Z)-1-(3,5-dichlorophenyl)-3-(dimethylaminomethylidene)indol-2-one (PubChem CID 13339481) has the molecular formula C17H14Cl2N2O and a molecular weight of 333.22 g/mol. Its IUPAC name is (3Z)-1-(3,5-dichlorophenyl)-3-(dimethylaminomethylidene)indol-2-one.
| Compound Name | (3Z)-1-(3,5-dichlorophenyl)-3-(dimethylaminomethylidene)indol-2-one |
|---|---|
| PubChem CID | 13339481 |
| Molecular Formula | C17H14Cl2N2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | (3Z)-1-(3,5-dichlorophenyl)-3-(dimethylaminomethylidene)indol-2-one |
| SMILES | CN(C)/C=C1\C(=O)N(c2cc(Cl)cc(Cl)c2)c2ccccc21 |
| InChI | InChI=1S/C17H14Cl2N2O/c1-20(2)10-15-14-5-3-4-6-16(14)21(17(15)22)13-8-11(18)7-12(19)9-13/h3-10H,1-2H3/b15-10- |
| InChIKey | PJERYLOUCRZXMY-GDNBJRDFSA-N |
| XLogP | 4.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|