C17H21N3 — CID 133394906
4,6-dimethyl-N-(1-phenylpent-4-enyl)pyrimidin-2-amine (PubChem CID 133394906) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 4,6-dimethyl-N-(1-phenylpent-4-enyl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethyl-N-(1-phenylpent-4-enyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 133394906 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4,6-dimethyl-N-(1-phenylpent-4-enyl)pyrimidin-2-amine |
| SMILES | C=CCCC(Nc1nc(C)cc(C)n1)c1ccccc1 |
| InChI | InChI=1S/C17H21N3/c1-4-5-11-16(15-9-7-6-8-10-15)20-17-18-13(2)12-14(3)19-17/h4,6-10,12,16H,1,5,11H2,2-3H3,(H,18,19,20) |
| InChIKey | FDMKQHBIOVRMTO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|