C21H25N5 — CID 21149287
N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2-diphenylethyl)methanetriamine (PubChem CID 21149287) has the molecular formula C21H25N5 and a molecular weight of 347.47 g/mol. Its IUPAC name is N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2-diphenylethyl)methanetriamine.
| Compound Name | N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2-diphenylethyl)methanetriamine |
|---|---|
| PubChem CID | 21149287 |
| Molecular Formula | C21H25N5 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | N"-(4,6-dimethylpyrimidin-2-yl)-N'-(2,2-diphenylethyl)methanetriamine |
| SMILES | Cc1cc(C)nc(NC(N)NCC(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C21H25N5/c1-15-13-16(2)25-21(24-15)26-20(22)23-14-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-13,19-20,23H,14,22H2,1-2H3,(H,24,25,26) |
| InChIKey | ZWPRZTTZSZYQTM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|