C16H17FN2 — CID 133394883
6-fluoro-N-(1-phenylpent-4-enyl)pyridin-2-amine (PubChem CID 133394883) has the molecular formula C16H17FN2 and a molecular weight of 256.32 g/mol. Its IUPAC name is 6-fluoro-N-(1-phenylpent-4-enyl)pyridin-2-amine.
| Compound Name | 6-fluoro-N-(1-phenylpent-4-enyl)pyridin-2-amine |
|---|---|
| PubChem CID | 133394883 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 6-fluoro-N-(1-phenylpent-4-enyl)pyridin-2-amine |
| SMILES | C=CCCC(Nc1cccc(F)n1)c1ccccc1 |
| InChI | InChI=1S/C16H17FN2/c1-2-3-10-14(13-8-5-4-6-9-13)18-16-12-7-11-15(17)19-16/h2,4-9,11-12,14H,1,3,10H2,(H,18,19) |
| InChIKey | UDAAKTJJAWKBQI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|