C17H16F3N5 — CID 133394890
N-(1-phenylpent-4-enyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 133394890) has the molecular formula C17H16F3N5 and a molecular weight of 347.34 g/mol. Its IUPAC name is N-(1-phenylpent-4-enyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-(1-phenylpent-4-enyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 133394890 |
| Molecular Formula | C17H16F3N5 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-(1-phenylpent-4-enyl)-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | C=CCCC(Nc1ccc2nnc(C(F)(F)F)n2n1)c1ccccc1 |
| InChI | InChI=1S/C17H16F3N5/c1-2-3-9-13(12-7-5-4-6-8-12)21-14-10-11-15-22-23-16(17(18,19)20)25(15)24-14/h2,4-8,10-11,13H,1,3,9H2,(H,21,24) |
| InChIKey | HLSPOOZNJOIXND-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|