C16H10F9N5 — CID 172574458
3-(trifluoromethyl)-N-[3,3,3-trifluoro-1-[4-(trifluoromethyl)phenyl]propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 172574458) has the molecular formula C16H10F9N5 and a molecular weight of 443.27 g/mol. Its IUPAC name is 3-(trifluoromethyl)-N-[3,3,3-trifluoro-1-[4-(trifluoromethyl)phenyl]propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | 3-(trifluoromethyl)-N-[3,3,3-trifluoro-1-[4-(trifluoromethyl)phenyl]propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 172574458 |
| Molecular Formula | C16H10F9N5 |
| Molecular Weight | 443.27 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-(trifluoromethyl)-N-[3,3,3-trifluoro-1-[4-(trifluoromethyl)phenyl]propyl]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | FC(F)(F)CC(Nc1ccc2nnc(C(F)(F)F)n2n1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H10F9N5/c17-14(18,19)7-10(8-1-3-9(4-2-8)15(20,21)22)26-11-5-6-12-27-28-13(16(23,24)25)30(12)29-11/h1-6,10H,7H2,(H,26,29) |
| InChIKey | NGYSABZAGLQKGE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.27 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |