C16H25BrN4O3 — CID 133395634
tert-butyl N-[1-(5-bromo-1-methyl-6-oxopyridazin-4-yl)-2-methylpiperidin-4-yl]carbamate (PubChem CID 133395634) has the molecular formula C16H25BrN4O3 and a molecular weight of 401.31 g/mol. Its IUPAC name is tert-butyl N-[1-(5-bromo-1-methyl-6-oxopyridazin-4-yl)-2-methylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-(5-bromo-1-methyl-6-oxopyridazin-4-yl)-2-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 133395634 |
| Molecular Formula | C16H25BrN4O3 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | tert-butyl N-[1-(5-bromo-1-methyl-6-oxopyridazin-4-yl)-2-methylpiperidin-4-yl]carbamate |
| SMILES | CC1CC(NC(=O)OC(C)(C)C)CCN1c1cnn(C)c(=O)c1Br |
| InChI | InChI=1S/C16H25BrN4O3/c1-10-8-11(19-15(23)24-16(2,3)4)6-7-21(10)12-9-18-20(5)14(22)13(12)17/h9-11H,6-8H2,1-5H3,(H,19,23) |
| InChIKey | ZNSDYQGYCVLTSJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |