C24H28N6O — CID 133397011
1-[[1-(6-ethyl-2-pyridin-2-ylpyrimidin-4-yl)piperidin-2-yl]methyl]-3-phenylurea (PubChem CID 133397011) has the molecular formula C24H28N6O and a molecular weight of 416.53 g/mol. Its IUPAC name is 1-[[1-(6-ethyl-2-pyridin-2-ylpyrimidin-4-yl)piperidin-2-yl]methyl]-3-phenylurea.
| Compound Name | 1-[[1-(6-ethyl-2-pyridin-2-ylpyrimidin-4-yl)piperidin-2-yl]methyl]-3-phenylurea |
|---|---|
| PubChem CID | 133397011 |
| Molecular Formula | C24H28N6O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-[[1-(6-ethyl-2-pyridin-2-ylpyrimidin-4-yl)piperidin-2-yl]methyl]-3-phenylurea |
| SMILES | CCc1cc(N2CCCCC2CNC(=O)Nc2ccccc2)nc(-c2ccccn2)n1 |
| InChI | InChI=1S/C24H28N6O/c1-2-18-16-22(29-23(27-18)21-13-6-8-14-25-21)30-15-9-7-12-20(30)17-26-24(31)28-19-10-4-3-5-11-19/h3-6,8,10-11,13-14,16,20H,2,7,9,12,15,17H2,1H3,(H2,26,28,31) |
| InChIKey | VKPVHPQERHMORP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |