C20H22N6O — CID 133397025
1-phenyl-3-[(1-pyrido[2,3-b]pyrazin-6-ylpiperidin-2-yl)methyl]urea (PubChem CID 133397025) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is 1-phenyl-3-[(1-pyrido[2,3-b]pyrazin-6-ylpiperidin-2-yl)methyl]urea.
| Compound Name | 1-phenyl-3-[(1-pyrido[2,3-b]pyrazin-6-ylpiperidin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 133397025 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 1-phenyl-3-[(1-pyrido[2,3-b]pyrazin-6-ylpiperidin-2-yl)methyl]urea |
| SMILES | O=C(NCC1CCCCN1c1ccc2nccnc2n1)Nc1ccccc1 |
| InChI | InChI=1S/C20H22N6O/c27-20(24-15-6-2-1-3-7-15)23-14-16-8-4-5-13-26(16)18-10-9-17-19(25-18)22-12-11-21-17/h1-3,6-7,9-12,16H,4-5,8,13-14H2,(H2,23,24,27) |
| InChIKey | DQZDCIWUIOOVDK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |