C15H24N4O4S — CID 133401588
N-[1-(4-methylpiperazin-1-yl)propan-2-yl]-3-methylsulfonyl-4-nitroaniline (PubChem CID 133401588) has the molecular formula C15H24N4O4S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-[1-(4-methylpiperazin-1-yl)propan-2-yl]-3-methylsulfonyl-4-nitroaniline.
| Compound Name | N-[1-(4-methylpiperazin-1-yl)propan-2-yl]-3-methylsulfonyl-4-nitroaniline |
|---|---|
| PubChem CID | 133401588 |
| Molecular Formula | C15H24N4O4S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | N-[1-(4-methylpiperazin-1-yl)propan-2-yl]-3-methylsulfonyl-4-nitroaniline |
| SMILES | CC(CN1CCN(C)CC1)Nc1ccc([N+](=O)[O-])c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H24N4O4S/c1-12(11-18-8-6-17(2)7-9-18)16-13-4-5-14(19(20)21)15(10-13)24(3,22)23/h4-5,10,12,16H,6-9,11H2,1-3H3 |
| InChIKey | GTZOPTSSNNWUKZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 95.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|