C15H20F3N5O4 — CID 124559492
N-[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl]-2,6-dinitro-4-(trifluoromethyl)aniline (PubChem CID 124559492) has the molecular formula C15H20F3N5O4 and a molecular weight of 391.35 g/mol. Its IUPAC name is N-[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl]-2,6-dinitro-4-(trifluoromethyl)aniline.
| Compound Name | N-[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl]-2,6-dinitro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 124559492 |
| Molecular Formula | C15H20F3N5O4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-[(2S)-1-(4-methylpiperazin-1-yl)propan-2-yl]-2,6-dinitro-4-(trifluoromethyl)aniline |
| SMILES | C[C@@H](CN1CCN(C)CC1)Nc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20F3N5O4/c1-10(9-21-5-3-20(2)4-6-21)19-14-12(22(24)25)7-11(15(16,17)18)8-13(14)23(26)27/h7-8,10,19H,3-6,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | JLCQVWXVBYMVOP-JTQLQIEISA-N |
| XLogP | 2.57 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|