C19H22F3N3O5 — CID 3334462
3-[1-[2,6-dinitro-4-(trifluoromethyl)anilino]ethyl]adamantan-1-ol (PubChem CID 3334462) has the molecular formula C19H22F3N3O5 and a molecular weight of 429.40 g/mol. Its IUPAC name is 3-[1-[2,6-dinitro-4-(trifluoromethyl)anilino]ethyl]adamantan-1-ol.
| Compound Name | 3-[1-[2,6-dinitro-4-(trifluoromethyl)anilino]ethyl]adamantan-1-ol |
|---|---|
| PubChem CID | 3334462 |
| Molecular Formula | C19H22F3N3O5 |
| Molecular Weight | 429.40 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 3-[1-[2,6-dinitro-4-(trifluoromethyl)anilino]ethyl]adamantan-1-ol |
| SMILES | CC(Nc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-])C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C19H22F3N3O5/c1-10(17-5-11-2-12(6-17)8-18(26,7-11)9-17)23-16-14(24(27)28)3-13(19(20,21)22)4-15(16)25(29)30/h3-4,10-12,23,26H,2,5-9H2,1H3 |
| InChIKey | BKGQDHJNBGUGPK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 118.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|