C17H19N3O3 — CID 133406905
ethyl 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)pentanoate (PubChem CID 133406905) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is ethyl 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)pentanoate.
| Compound Name | ethyl 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)pentanoate |
|---|---|
| PubChem CID | 133406905 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | ethyl 4-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)pentanoate |
| SMILES | CCOC(=O)CCC(C)Nc1ncnc2c1oc1ccccc12 |
| InChI | InChI=1S/C17H19N3O3/c1-3-22-14(21)9-8-11(2)20-17-16-15(18-10-19-17)12-6-4-5-7-13(12)23-16/h4-7,10-11H,3,8-9H2,1-2H3,(H,18,19,20) |
| InChIKey | QBMXDLQTXFOSBB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |