C18H14ClN3O2 — CID 133445052
2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-2-(4-chlorophenyl)ethanol (PubChem CID 133445052) has the molecular formula C18H14ClN3O2 and a molecular weight of 339.78 g/mol. Its IUPAC name is 2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-2-(4-chlorophenyl)ethanol.
| Compound Name | 2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-2-(4-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 133445052 |
| Molecular Formula | C18H14ClN3O2 |
| Molecular Weight | 339.78 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-([1]benzofuro[3,2-d]pyrimidin-4-ylamino)-2-(4-chlorophenyl)ethanol |
| SMILES | OCC(Nc1ncnc2c1oc1ccccc12)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14ClN3O2/c19-12-7-5-11(6-8-12)14(9-23)22-18-17-16(20-10-21-18)13-3-1-2-4-15(13)24-17/h1-8,10,14,23H,9H2,(H,20,21,22) |
| InChIKey | FYTDWHOPVRCIEC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.78 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |