C12H13N3S3 — CID 133407460
(6-methylthieno[2,3-d]pyrimidin-4-yl) pyrrolidine-1-carbodithioate (PubChem CID 133407460) has the molecular formula C12H13N3S3 and a molecular weight of 295.46 g/mol. Its IUPAC name is (6-methylthieno[2,3-d]pyrimidin-4-yl) pyrrolidine-1-carbodithioate.
| Compound Name | (6-methylthieno[2,3-d]pyrimidin-4-yl) pyrrolidine-1-carbodithioate |
|---|---|
| PubChem CID | 133407460 |
| Molecular Formula | C12H13N3S3 |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (6-methylthieno[2,3-d]pyrimidin-4-yl) pyrrolidine-1-carbodithioate |
| SMILES | Cc1cc2c(SC(=S)N3CCCC3)ncnc2s1 |
| InChI | InChI=1S/C12H13N3S3/c1-8-6-9-10(17-8)13-7-14-11(9)18-12(16)15-4-2-3-5-15/h6-7H,2-5H2,1H3 |
| InChIKey | NGLHIJKLCXULMW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|