C13H19N5O2S2 — CID 10193507
[6-(methylamino)-5-nitropyrimidin-4-yl] azocane-1-carbodithioate (PubChem CID 10193507) has the molecular formula C13H19N5O2S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is [6-(methylamino)-5-nitropyrimidin-4-yl] azocane-1-carbodithioate.
| Compound Name | [6-(methylamino)-5-nitropyrimidin-4-yl] azocane-1-carbodithioate |
|---|---|
| PubChem CID | 10193507 |
| Molecular Formula | C13H19N5O2S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [6-(methylamino)-5-nitropyrimidin-4-yl] azocane-1-carbodithioate |
| SMILES | CNc1ncnc(SC(=S)N2CCCCCCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19N5O2S2/c1-14-11-10(18(19)20)12(16-9-15-11)22-13(21)17-7-5-3-2-4-6-8-17/h9H,2-8H2,1H3,(H,14,15,16) |
| InChIKey | QNQAAKBQQVEHGY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|